About 1-benzofuran;piperazine
1-benzofuran;piperazine (PubChem CID 68691578) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-benzofuran;piperazine.
Molecular Properties
| Compound Name | 1-benzofuran;piperazine |
| PubChem CID | 68691578 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-benzofuran;piperazine |
| SMILES | C1CNCCN1.c1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O.C4H10N2/c1-2-4-8-7(3-1)5-6-9-8;1-2-6-4-3-5-1/h1-6H;5-6H,1-4H2 |
| InChIKey | NRYMRPLQESXQEQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzofuran;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;piperazine?
The IUPAC name of 1-benzofuran;piperazine (CID 68691578) is 1-benzofuran;piperazine.
What is the SMILES notation for 1-benzofuran;piperazine?
The canonical SMILES for 1-benzofuran;piperazine is C1CNCCN1.c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;piperazine?
The InChIKey is NRYMRPLQESXQEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C4H10N2/c1-2-4-8-7(3-1)5-6-9-8;1-2-6-4-3-5-1/h1-6H;5-6H,1-4H2.
What are the key properties of 1-benzofuran;piperazine?
1-benzofuran;piperazine has a molecular weight of 204.27 g/mol, XLogP of 1.61, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;piperazine is sourced from PubChem (CID 68691578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).