About 4-imidazol-1-ylaniline;trihydrochloride
4-imidazol-1-ylaniline;trihydrochloride (PubChem CID 68693958) has the molecular formula C9H12Cl3N3
and a molecular weight of 268.58 g/mol. Its IUPAC name is 4-imidazol-1-ylaniline;trihydrochloride.
Molecular Properties
| Compound Name | 4-imidazol-1-ylaniline;trihydrochloride |
| PubChem CID | 68693958 |
| Molecular Formula | C9H12Cl3N3 |
| Molecular Weight | 268.58 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 4-imidazol-1-ylaniline;trihydrochloride |
| SMILES | Cl.Cl.Cl.Nc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C9H9N3.3ClH/c10-8-1-3-9(4-2-8)12-6-5-11-7-12;;;/h1-7H,10H2;3*1H |
| InChIKey | YBKQCULCWXJYAV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-imidazol-1-ylaniline;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazol-1-ylaniline;trihydrochloride?
The IUPAC name of 4-imidazol-1-ylaniline;trihydrochloride (CID 68693958) is 4-imidazol-1-ylaniline;trihydrochloride.
What is the SMILES notation for 4-imidazol-1-ylaniline;trihydrochloride?
The canonical SMILES for 4-imidazol-1-ylaniline;trihydrochloride is Cl.Cl.Cl.Nc1ccc(-n2ccnc2)cc1.
What is the InChIKey of 4-imidazol-1-ylaniline;trihydrochloride?
The InChIKey is YBKQCULCWXJYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.3ClH/c10-8-1-3-9(4-2-8)12-6-5-11-7-12;;;/h1-7H,10H2;3*1H.
What are the key properties of 4-imidazol-1-ylaniline;trihydrochloride?
4-imidazol-1-ylaniline;trihydrochloride has a molecular weight of 268.58 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazol-1-ylaniline;trihydrochloride is sourced from PubChem (CID 68693958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).