About 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride
6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride (PubChem CID 68693984) has the molecular formula C11H11ClN2O
and a molecular weight of 222.68 g/mol. Its IUPAC name is 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride.
Molecular Properties
| Compound Name | 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride |
| PubChem CID | 68693984 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride |
| SMILES | Cl.[H]/N=C1\C=CC=CC1=C1C=CC=CN1O |
| InChI | InChI=1S/C11H10N2O.ClH/c12-10-6-2-1-5-9(10)11-7-3-4-8-13(11)14;/h1-8,12,14H;1H/b11-9?,12-10+; |
| InChIKey | DUAYELFRUKLNTM-DHTRHBLWSA-N |
| XLogP | 2.58 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride?
The IUPAC name of 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride (CID 68693984) is 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride.
What is the SMILES notation for 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride?
The canonical SMILES for 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride is Cl.[H]/N=C1\C=CC=CC1=C1C=CC=CN1O.
What is the InChIKey of 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride?
The InChIKey is DUAYELFRUKLNTM-DHTRHBLWSA-N. The full InChI is InChI=1S/C11H10N2O.ClH/c12-10-6-2-1-5-9(10)11-7-3-4-8-13(11)14;/h1-8,12,14H;1H/b11-9?,12-10+;.
What are the key properties of 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride?
6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride has a molecular weight of 222.68 g/mol, XLogP of 2.58, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-hydroxy-2-pyridinylidene)cyclohexa-2,4-dien-1-imine;hydrochloride is sourced from PubChem (CID 68693984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).