About 5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine
5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine (PubChem CID 68694121) has the molecular formula C7H10N2O
and a molecular weight of 138.17 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine.
Analyze 5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine?
The IUPAC name of 5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine (CID 68694121) is 5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine.
What is the SMILES notation for 5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine?
The canonical SMILES for 5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine is c1noc2c1CCCNC2.
What is the InChIKey of 5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine?
The InChIKey is JAUCNRWNTGMQIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O/c1-2-6-4-9-10-7(6)5-8-3-1/h4,8H,1-3,5H2.
What are the key properties of 5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine?
5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine has a molecular weight of 138.17 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydro-4H-[1,2]oxazolo[5,4-c]azepine is sourced from PubChem (CID 68694121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).