About 2,3-dihydro-1,4-benzodioxine;piperazine
2,3-dihydro-1,4-benzodioxine;piperazine (PubChem CID 68694467) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxine;piperazine.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-benzodioxine;piperazine |
| PubChem CID | 68694467 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxine;piperazine |
| SMILES | C1CNCCN1.c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C8H8O2.C4H10N2/c1-2-4-8-7(3-1)9-5-6-10-8;1-2-6-4-3-5-1/h1-4H,5-6H2;5-6H,1-4H2 |
| InChIKey | PJWGPYWLQZLALY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydro-1,4-benzodioxine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-benzodioxine;piperazine?
The IUPAC name of 2,3-dihydro-1,4-benzodioxine;piperazine (CID 68694467) is 2,3-dihydro-1,4-benzodioxine;piperazine.
What is the SMILES notation for 2,3-dihydro-1,4-benzodioxine;piperazine?
The canonical SMILES for 2,3-dihydro-1,4-benzodioxine;piperazine is C1CNCCN1.c1ccc2c(c1)OCCO2.
What is the InChIKey of 2,3-dihydro-1,4-benzodioxine;piperazine?
The InChIKey is PJWGPYWLQZLALY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C4H10N2/c1-2-4-8-7(3-1)9-5-6-10-8;1-2-6-4-3-5-1/h1-4H,5-6H2;5-6H,1-4H2.
What are the key properties of 2,3-dihydro-1,4-benzodioxine;piperazine?
2,3-dihydro-1,4-benzodioxine;piperazine has a molecular weight of 222.29 g/mol, XLogP of 0.64, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-benzodioxine;piperazine is sourced from PubChem (CID 68694467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).