C29H39Cl2N7O — CID 68694782
4-[[(1S,2R)-2-[[amino(pyridin-2-yl)methylidene]amino]cyclohexyl]amino]-N-(cyclohexylmethyl)-6-methylquinazoline-2-carboxamide;dihydrochloride (PubChem CID 68694782) has the molecular formula C29H39Cl2N7O and a molecular weight of 572.59 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-[[amino(pyridin-2-yl)methylidene]amino]cyclohexyl]amino]-N-(cyclohexylmethyl)-6-methylquinazoline-2-carboxamide;dihydrochloride.
| Compound Name | 4-[[(1S,2R)-2-[[amino(pyridin-2-yl)methylidene]amino]cyclohexyl]amino]-N-(cyclohexylmethyl)-6-methylquinazoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 68694782 |
| Molecular Formula | C29H39Cl2N7O |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | 4-[[(1S,2R)-2-[[amino(pyridin-2-yl)methylidene]amino]cyclohexyl]amino]-N-(cyclohexylmethyl)-6-methylquinazoline-2-carboxamide;dihydrochloride |
| SMILES | Cc1ccc2nc(C(=O)NCC3CCCCC3)nc(N[C@H]3CCCC[C@H]3/N=C(\N)c3ccccn3)c2c1.Cl.Cl |
| InChI | InChI=1S/C29H37N7O.2ClH/c1-19-14-15-22-21(17-19)27(36-28(34-22)29(37)32-18-20-9-3-2-4-10-20)35-24-12-6-5-11-23(24)33-26(30)25-13-7-8-16-31-25;;/h7-8,13-17,20,23-24H,2-6,9-12,18H2,1H3,(H2,30,33)(H,32,37)(H,34,35,36);2*1H/t23-,24+;;/m1../s1 |
| InChIKey | GILUFPQWHLHLEW-WCJQCITJSA-N |
| XLogP | 5.62 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|