C23H36Cl2N6O2 — CID 68694922
4-[[(1S,2R)-2-[(1-amino-2-methoxyethylidene)amino]cyclohexyl]amino]-6-methyl-N-(2-methylpropyl)quinazoline-2-carboxamide;dihydrochloride (PubChem CID 68694922) has the molecular formula C23H36Cl2N6O2 and a molecular weight of 499.49 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-[(1-amino-2-methoxyethylidene)amino]cyclohexyl]amino]-6-methyl-N-(2-methylpropyl)quinazoline-2-carboxamide;dihydrochloride.
| Compound Name | 4-[[(1S,2R)-2-[(1-amino-2-methoxyethylidene)amino]cyclohexyl]amino]-6-methyl-N-(2-methylpropyl)quinazoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 68694922 |
| Molecular Formula | C23H36Cl2N6O2 |
| Molecular Weight | 499.49 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 4-[[(1S,2R)-2-[(1-amino-2-methoxyethylidene)amino]cyclohexyl]amino]-6-methyl-N-(2-methylpropyl)quinazoline-2-carboxamide;dihydrochloride |
| SMILES | COC/C(N)=N\[C@@H]1CCCC[C@@H]1Nc1nc(C(=O)NCC(C)C)nc2ccc(C)cc12.Cl.Cl |
| InChI | InChI=1S/C23H34N6O2.2ClH/c1-14(2)12-25-23(30)22-27-17-10-9-15(3)11-16(17)21(29-22)28-19-8-6-5-7-18(19)26-20(24)13-31-4;;/h9-11,14,18-19H,5-8,12-13H2,1-4H3,(H2,24,26)(H,25,30)(H,27,28,29);2*1H/t18-,19+;;/m1../s1 |
| InChIKey | RWQJWCFWBXXWLP-QNCHGCKQSA-N |
| XLogP | 3.89 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|