C24H22N4O2 — CID 68695523
2-amino-5-[3-(1,3-dihydro-2-benzofuran-1-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylbenzamide (PubChem CID 68695523) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 2-amino-5-[3-(1,3-dihydro-2-benzofuran-1-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylbenzamide.
| Compound Name | 2-amino-5-[3-(1,3-dihydro-2-benzofuran-1-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 68695523 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-amino-5-[3-(1,3-dihydro-2-benzofuran-1-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(-c2cnc3[nH]cc(C4OCc5ccccc54)c3c2)ccc1N |
| InChI | InChI=1S/C24H22N4O2/c1-28(2)24(29)19-9-14(7-8-21(19)25)16-10-18-20(12-27-23(18)26-11-16)22-17-6-4-3-5-15(17)13-30-22/h3-12,22H,13,25H2,1-2H3,(H,26,27) |
| InChIKey | PFFKZVVIDOIOTC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|