C32H31NO3 — CID 68695597
5-(4-tert-butylphenyl)-1-(6-propan-2-yloxynaphthalen-2-yl)indole-2-carboxylic acid (PubChem CID 68695597) has the molecular formula C32H31NO3 and a molecular weight of 477.60 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-1-(6-propan-2-yloxynaphthalen-2-yl)indole-2-carboxylic acid.
| Compound Name | 5-(4-tert-butylphenyl)-1-(6-propan-2-yloxynaphthalen-2-yl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68695597 |
| Molecular Formula | C32H31NO3 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 5-(4-tert-butylphenyl)-1-(6-propan-2-yloxynaphthalen-2-yl)indole-2-carboxylic acid |
| SMILES | CC(C)Oc1ccc2cc(-n3c(C(=O)O)cc4cc(-c5ccc(C(C)(C)C)cc5)ccc43)ccc2c1 |
| InChI | InChI=1S/C32H31NO3/c1-20(2)36-28-14-9-23-17-27(13-8-24(23)18-28)33-29-15-10-22(16-25(29)19-30(33)31(34)35)21-6-11-26(12-7-21)32(3,4)5/h6-20H,1-5H3,(H,34,35) |
| InChIKey | DMVDFRNGPYUJMI-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |