C28H38Cl2N6O3 — CID 68696688
4-[[(1S,2R)-2-[[amino(furan-2-yl)methylidene]amino]cyclohexyl]amino]-N-(4-methoxycyclohexyl)-6-methylquinazoline-2-carboxamide;dihydrochloride (PubChem CID 68696688) has the molecular formula C28H38Cl2N6O3 and a molecular weight of 577.56 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-[[amino(furan-2-yl)methylidene]amino]cyclohexyl]amino]-N-(4-methoxycyclohexyl)-6-methylquinazoline-2-carboxamide;dihydrochloride.
| Compound Name | 4-[[(1S,2R)-2-[[amino(furan-2-yl)methylidene]amino]cyclohexyl]amino]-N-(4-methoxycyclohexyl)-6-methylquinazoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 68696688 |
| Molecular Formula | C28H38Cl2N6O3 |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 4-[[(1S,2R)-2-[[amino(furan-2-yl)methylidene]amino]cyclohexyl]amino]-N-(4-methoxycyclohexyl)-6-methylquinazoline-2-carboxamide;dihydrochloride |
| SMILES | COC1CCC(NC(=O)c2nc(N[C@H]3CCCC[C@H]3/N=C(\N)c3ccco3)c3cc(C)ccc3n2)CC1.Cl.Cl |
| InChI | InChI=1S/C28H36N6O3.2ClH/c1-17-9-14-21-20(16-17)26(34-27(32-21)28(35)30-18-10-12-19(36-2)13-11-18)33-23-7-4-3-6-22(23)31-25(29)24-8-5-15-37-24;;/h5,8-9,14-16,18-19,22-23H,3-4,6-7,10-13H2,1-2H3,(H2,29,31)(H,30,35)(H,32,33,34);2*1H/t18?,19?,22-,23+;;/m1../s1 |
| InChIKey | SYKWQVBCSBXXQD-AKWHVLBESA-N |
| XLogP | 5.19 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|