C34H48N4O — CID 68697793
(2R,3S)-3-amino-1-[[1-(3-tert-butylphenyl)cyclopropyl]amino]-4-[4-[(6-methyl-2-pyridinyl)amino]-3-pentylphenyl]butan-2-ol (PubChem CID 68697793) has the molecular formula C34H48N4O and a molecular weight of 528.79 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-[[1-(3-tert-butylphenyl)cyclopropyl]amino]-4-[4-[(6-methyl-2-pyridinyl)amino]-3-pentylphenyl]butan-2-ol.
| Compound Name | (2R,3S)-3-amino-1-[[1-(3-tert-butylphenyl)cyclopropyl]amino]-4-[4-[(6-methyl-2-pyridinyl)amino]-3-pentylphenyl]butan-2-ol |
|---|---|
| PubChem CID | 68697793 |
| Molecular Formula | C34H48N4O |
| Molecular Weight | 528.79 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | (2R,3S)-3-amino-1-[[1-(3-tert-butylphenyl)cyclopropyl]amino]-4-[4-[(6-methyl-2-pyridinyl)amino]-3-pentylphenyl]butan-2-ol |
| SMILES | CCCCCc1cc(C[C@H](N)[C@H](O)CNC2(c3cccc(C(C)(C)C)c3)CC2)ccc1Nc1cccc(C)n1 |
| InChI | InChI=1S/C34H48N4O/c1-6-7-8-12-26-20-25(16-17-30(26)38-32-15-9-11-24(2)37-32)21-29(35)31(39)23-36-34(18-19-34)28-14-10-13-27(22-28)33(3,4)5/h9-11,13-17,20,22,29,31,36,39H,6-8,12,18-19,21,23,35H2,1-5H3,(H,37,38)/t29-,31+/m0/s1 |
| InChIKey | RFDJHTXGGOZDNG-IGYGKHONSA-N |
| XLogP | 6.67 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.79 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|