C21H33Cl2N7O — CID 68697888
4-[[(1S,2R)-2-(hydrazinylmethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-methylpropyl)quinazoline-2-carboxamide;dihydrochloride (PubChem CID 68697888) has the molecular formula C21H33Cl2N7O and a molecular weight of 470.45 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-(hydrazinylmethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-methylpropyl)quinazoline-2-carboxamide;dihydrochloride.
| Compound Name | 4-[[(1S,2R)-2-(hydrazinylmethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-methylpropyl)quinazoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 68697888 |
| Molecular Formula | C21H33Cl2N7O |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 4-[[(1S,2R)-2-(hydrazinylmethylideneamino)cyclohexyl]amino]-6-methyl-N-(2-methylpropyl)quinazoline-2-carboxamide;dihydrochloride |
| SMILES | Cc1ccc2nc(C(=O)NCC(C)C)nc(N[C@H]3CCCC[C@H]3/N=C/NN)c2c1.Cl.Cl |
| InChI | InChI=1S/C21H31N7O.2ClH/c1-13(2)11-23-21(29)20-26-16-9-8-14(3)10-15(16)19(28-20)27-18-7-5-4-6-17(18)24-12-25-22;;/h8-10,12-13,17-18H,4-7,11,22H2,1-3H3,(H,23,29)(H,24,25)(H,26,27,28);2*1H/t17-,18+;;/m1../s1 |
| InChIKey | ZXCDIZGZARDMEB-WCRQIBMVSA-N |
| XLogP | 3.38 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|