C28H35F2N3O4 — CID 68698588
N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(4S)-6-[[(3R)-oxolan-3-yl]amino]spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butan-2-yl]acetamide (PubChem CID 68698588) has the molecular formula C28H35F2N3O4 and a molecular weight of 515.60 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(4S)-6-[[(3R)-oxolan-3-yl]amino]spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(4S)-6-[[(3R)-oxolan-3-yl]amino]spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 68698588 |
| Molecular Formula | C28H35F2N3O4 |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[(4S)-6-[[(3R)-oxolan-3-yl]amino]spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]butan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CN[C@H]1CC2(CCC2)Oc2ccc(N[C@@H]3CCOC3)cc21 |
| InChI | InChI=1S/C28H35F2N3O4/c1-17(34)32-24(11-18-9-19(29)12-20(30)10-18)26(35)15-31-25-14-28(6-2-7-28)37-27-4-3-21(13-23(25)27)33-22-5-8-36-16-22/h3-4,9-10,12-13,22,24-26,31,33,35H,2,5-8,11,14-16H2,1H3,(H,32,34)/t22-,24+,25+,26-/m1/s1 |
| InChIKey | LWMAJQIGWITIPX-HMNRDNJPSA-N |
| XLogP | 3.61 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|