C29H36F3N3O4 — CID 68699581
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4S)-7-fluoro-6-(oxan-4-ylamino)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxybutan-2-yl]acetamide (PubChem CID 68699581) has the molecular formula C29H36F3N3O4 and a molecular weight of 547.62 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4S)-7-fluoro-6-(oxan-4-ylamino)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4S)-7-fluoro-6-(oxan-4-ylamino)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 68699581 |
| Molecular Formula | C29H36F3N3O4 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4S)-7-fluoro-6-(oxan-4-ylamino)spiro[3,4-dihydrochromene-2,1'-cyclobutane]-4-yl]amino]-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CN[C@H]1CC2(CCC2)Oc2cc(F)c(NC3CCOCC3)cc21 |
| InChI | InChI=1S/C29H36F3N3O4/c1-17(36)34-25(11-18-9-19(30)12-20(31)10-18)27(37)16-33-26-15-29(5-2-6-29)39-28-14-23(32)24(13-22(26)28)35-21-3-7-38-8-4-21/h9-10,12-14,21,25-27,33,35,37H,2-8,11,15-16H2,1H3,(H,34,36)/t25-,26-,27+/m0/s1 |
| InChIKey | ZGAZNGKMTWTJNV-GMQQYTKMSA-N |
| XLogP | 4.14 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|