C22H16N6O6 — CID 6870006
2-nitro-N-[(E)-[4-[(E)-[(2-nitrobenzoyl)hydrazinylidene]methyl]phenyl]methylideneamino]benzamide (PubChem CID 6870006) has the molecular formula C22H16N6O6 and a molecular weight of 460.41 g/mol. Its IUPAC name is 2-nitro-N-[(E)-[4-[(E)-[(2-nitrobenzoyl)hydrazinylidene]methyl]phenyl]methylideneamino]benzamide.
| Compound Name | 2-nitro-N-[(E)-[4-[(E)-[(2-nitrobenzoyl)hydrazinylidene]methyl]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 6870006 |
| Molecular Formula | C22H16N6O6 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 2-nitro-N-[(E)-[4-[(E)-[(2-nitrobenzoyl)hydrazinylidene]methyl]phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc(/C=N/NC(=O)c2ccccc2[N+](=O)[O-])cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H16N6O6/c29-21(17-5-1-3-7-19(17)27(31)32)25-23-13-15-9-11-16(12-10-15)14-24-26-22(30)18-6-2-4-8-20(18)28(33)34/h1-14H,(H,25,29)(H,26,30)/b23-13+,24-14+ |
| InChIKey | HURLKLLCJIAKBB-RNIAWFEPSA-N |
| XLogP | 3.03 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|