About 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile
2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile (PubChem CID 68700136) has the molecular formula C10H5N5O
and a molecular weight of 211.18 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile.
Molecular Properties
| Compound Name | 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile |
| PubChem CID | 68700136 |
| Molecular Formula | C10H5N5O |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile |
| SMILES | N#Cc1ccc2oc(-n3cncn3)nc2c1 |
| InChI | InChI=1S/C10H5N5O/c11-4-7-1-2-9-8(3-7)14-10(16-9)15-6-12-5-13-15/h1-3,5-6H |
| InChIKey | NSUJMPPYDLQFIB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile?
The IUPAC name of 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile (CID 68700136) is 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile.
What is the SMILES notation for 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile?
The canonical SMILES for 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile is N#Cc1ccc2oc(-n3cncn3)nc2c1.
What is the InChIKey of 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile?
The InChIKey is NSUJMPPYDLQFIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N5O/c11-4-7-1-2-9-8(3-7)14-10(16-9)15-6-12-5-13-15/h1-3,5-6H.
What are the key properties of 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile?
2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile has a molecular weight of 211.18 g/mol, XLogP of 1.28, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-triazol-1-yl)-1,3-benzoxazole-5-carbonitrile is sourced from PubChem (CID 68700136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).