About 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol
3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 68700782) has the molecular formula C15H8F3N3O4S
and a molecular weight of 383.31 g/mol. Its IUPAC name is 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol |
| PubChem CID | 68700782 |
| Molecular Formula | C15H8F3N3O4S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | O=[N+]([O-])c1cc(-c2csc(-c3cccnc3C(F)(F)F)n2)cc(O)c1O |
| InChI | InChI=1S/C15H8F3N3O4S/c16-15(17,18)13-8(2-1-3-19-13)14-20-9(6-26-14)7-4-10(21(24)25)12(23)11(22)5-7/h1-6,22-23H |
| InChIKey | VZZSMJYGWBVDNI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol?
The IUPAC name of 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol (CID 68700782) is 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol.
What is the SMILES notation for 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol?
The canonical SMILES for 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol is O=[N+]([O-])c1cc(-c2csc(-c3cccnc3C(F)(F)F)n2)cc(O)c1O.
What is the InChIKey of 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol?
The InChIKey is VZZSMJYGWBVDNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F3N3O4S/c16-15(17,18)13-8(2-1-3-19-13)14-20-9(6-26-14)7-4-10(21(24)25)12(23)11(22)5-7/h1-6,22-23H.
What are the key properties of 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol?
3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol has a molecular weight of 383.31 g/mol, XLogP of 4.21, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-5-[2-[2-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzene-1,2-diol is sourced from PubChem (CID 68700782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).