About 2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid
2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 68702340) has the molecular formula C9H11F3N2O4
and a molecular weight of 268.19 g/mol. Its IUPAC name is 2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid.
Analyze 2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid?
The IUPAC name of 2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid (CID 68702340) is 2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid?
The canonical SMILES for 2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid is Cc1cn(CC(=O)O)c(C)n1.O=C(O)C(F)(F)F.
What is the InChIKey of 2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid?
The InChIKey is AZDPJRRXPUOPPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2.C2HF3O2/c1-5-3-9(4-7(10)11)6(2)8-5;3-2(4,5)1(6)7/h3H,4H2,1-2H3,(H,10,11);(H,6,7).
What are the key properties of 2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid?
2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid has a molecular weight of 268.19 g/mol, XLogP of 1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylimidazol-1-yl)acetic acid;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 68702340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).