C16H15ClN8O3 — CID 6870252
N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide (PubChem CID 6870252) has the molecular formula C16H15ClN8O3 and a molecular weight of 402.80 g/mol. Its IUPAC name is N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide.
| Compound Name | N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 6870252 |
| Molecular Formula | C16H15ClN8O3 |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-[(E)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=N/NC(=O)CNc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H15ClN8O3/c1-9-11(13(17)25(24-9)10-5-3-2-4-6-10)7-19-21-12(26)8-18-14-15(27)20-16(28)23-22-14/h2-7H,8H2,1H3,(H,18,22)(H,21,26)(H2,20,23,27,28)/b19-7+ |
| InChIKey | IJQOTFRKYCMGQI-FBCYGCLPSA-N |
| XLogP | 0.17 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|