C23H25NO — CID 68703244
N-[(4-tert-butylphenyl)methyl]-2-naphthalen-2-ylacetamide (PubChem CID 68703244) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 68703244 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-2-naphthalen-2-ylacetamide |
| SMILES | CC(C)(C)c1ccc(CNC(=O)Cc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H25NO/c1-23(2,3)21-12-9-17(10-13-21)16-24-22(25)15-18-8-11-19-6-4-5-7-20(19)14-18/h4-14H,15-16H2,1-3H3,(H,24,25) |
| InChIKey | SYCNAPVCSXNZKR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |