C8H11NS — CID 68703920
3,3a,4,5-tetrahydro-2H-thieno[3,2-b]azepine (PubChem CID 68703920) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is 3,3a,4,5-tetrahydro-2H-thieno[3,2-b]azepine.
| Compound Name | 3,3a,4,5-tetrahydro-2H-thieno[3,2-b]azepine |
|---|---|
| PubChem CID | 68703920 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 3,3a,4,5-tetrahydro-2H-thieno[3,2-b]azepine |
| SMILES | C1=CCNC2CCSC2=C1 |
| InChI | InChI=1S/C8H11NS/c1-2-5-9-7-4-6-10-8(7)3-1/h1-3,7,9H,4-6H2 |
| InChIKey | ZCNHJEUFDGIEMT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |