About 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one
8-amino-4-methyl-1,3-dihydroquinoxalin-2-one (PubChem CID 68704055) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one.
Molecular Properties
| Compound Name | 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one |
| PubChem CID | 68704055 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one |
| SMILES | CN1CC(=O)Nc2c(N)cccc21 |
| InChI | InChI=1S/C9H11N3O/c1-12-5-8(13)11-9-6(10)3-2-4-7(9)12/h2-4H,5,10H2,1H3,(H,11,13) |
| InChIKey | HQWLHYFBGVTAMO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one?
The IUPAC name of 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one (CID 68704055) is 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one.
What is the SMILES notation for 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one?
The canonical SMILES for 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one is CN1CC(=O)Nc2c(N)cccc21.
What is the InChIKey of 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one?
The InChIKey is HQWLHYFBGVTAMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-12-5-8(13)11-9-6(10)3-2-4-7(9)12/h2-4H,5,10H2,1H3,(H,11,13).
What are the key properties of 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one?
8-amino-4-methyl-1,3-dihydroquinoxalin-2-one has a molecular weight of 177.21 g/mol, XLogP of 0.66, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-4-methyl-1,3-dihydroquinoxalin-2-one is sourced from PubChem (CID 68704055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).