C18H19N3S — CID 68704866
7-(3,4-dihydro-1H-isoquinolin-2-yl)-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine-4-thiol (PubChem CID 68704866) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is 7-(3,4-dihydro-1H-isoquinolin-2-yl)-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine-4-thiol.
| Compound Name | 7-(3,4-dihydro-1H-isoquinolin-2-yl)-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine-4-thiol |
|---|---|
| PubChem CID | 68704866 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 7-(3,4-dihydro-1H-isoquinolin-2-yl)-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine-4-thiol |
| SMILES | Cc1[nH]c2c(N3CCc4ccccc4C3)ncc(S)c2c1C |
| InChI | InChI=1S/C18H19N3S/c1-11-12(2)20-17-16(11)15(22)9-19-18(17)21-8-7-13-5-3-4-6-14(13)10-21/h3-6,9,20,22H,7-8,10H2,1-2H3 |
| InChIKey | ANSNTPNGJSPKIF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|