C34H34F3N3O8 — CID 68704910
3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enoic acid (PubChem CID 68704910) has the molecular formula C34H34F3N3O8 and a molecular weight of 669.65 g/mol. Its IUPAC name is 3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68704910 |
| Molecular Formula | C34H34F3N3O8 |
| Molecular Weight | 669.65 g/mol |
| Exact Mass | 669.23 |
| IUPAC Name | 3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)cc(OC)c1OC1CCN(CC(O)(c2cn(Cc3ccccc3)c3cc([N+](=O)[O-])ccc23)C(F)(F)F)CC1 |
| InChI | InChI=1S/C34H34F3N3O8/c1-46-29-16-23(8-11-31(41)42)17-30(47-2)32(29)48-25-12-14-38(15-13-25)21-33(43,34(35,36)37)27-20-39(19-22-6-4-3-5-7-22)28-18-24(40(44)45)9-10-26(27)28/h3-11,16-18,20,25,43H,12-15,19,21H2,1-2H3,(H,41,42) |
| InChIKey | WMJSPVLIAZLROK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 136.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|