C17H12F3N5O4 — CID 68705291
2-(3,4-dimethoxy-5-nitrophenyl)-4-[2-(trifluoromethyl)-3-pyridinyl]-1,3,5-triazine (PubChem CID 68705291) has the molecular formula C17H12F3N5O4 and a molecular weight of 407.31 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-5-nitrophenyl)-4-[2-(trifluoromethyl)-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2-(3,4-dimethoxy-5-nitrophenyl)-4-[2-(trifluoromethyl)-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 68705291 |
| Molecular Formula | C17H12F3N5O4 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2-(3,4-dimethoxy-5-nitrophenyl)-4-[2-(trifluoromethyl)-3-pyridinyl]-1,3,5-triazine |
| SMILES | COc1cc(-c2ncnc(-c3cccnc3C(F)(F)F)n2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C17H12F3N5O4/c1-28-12-7-9(6-11(25(26)27)13(12)29-2)15-22-8-23-16(24-15)10-4-3-5-21-14(10)17(18,19)20/h3-8H,1-2H3 |
| InChIKey | BFKUYEVAZSBWPO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 113.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|