About (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid
(3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (PubChem CID 687062) has the molecular formula C9H8O4
and a molecular weight of 180.16 g/mol. Its IUPAC name is (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid.
Molecular Properties
| Compound Name | (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| PubChem CID | 687062 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C9H8O4/c10-9(11)8-5-12-6-3-1-2-4-7(6)13-8/h1-4,8H,5H2,(H,10,11)/t8-/m1/s1 |
| InChIKey | HMBHAQMOBKLWRX-MRVPVSSYSA-N |
| XLogP | 0.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid?
The IUPAC name of (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (CID 687062) is (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid.
What is the SMILES notation for (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid?
The canonical SMILES for (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid is O=C(O)[C@H]1COc2ccccc2O1.
What is the InChIKey of (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid?
The InChIKey is HMBHAQMOBKLWRX-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H8O4/c10-9(11)8-5-12-6-3-1-2-4-7(6)13-8/h1-4,8H,5H2,(H,10,11)/t8-/m1/s1.
What are the key properties of (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid?
(3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid has a molecular weight of 180.16 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid is sourced from PubChem (CID 687062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).