(3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid

C9H8O4 — CID 687062

IUPAC(3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid
SMILESO=C(O)[C@H]1COc2ccccc2O1
InChIInChI=1S/C9H8O4/c10-9(11)8-5-12-6-3-1-2-4-7(6)13-8/h1-4,8H,5H2,(H,10,11)/t8-/m1/s1
InChIKeyHMBHAQMOBKLWRX-MRVPVSSYSA-N
MW180.16 g/mol
LogP0.91
Rot. Bonds1

About (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid

(3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (PubChem CID 687062) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid.

Molecular Properties

Compound Name(3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid
PubChem CID687062
Molecular FormulaC9H8O4
Molecular Weight180.16 g/mol
Exact Mass180.04
IUPAC Name(3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid
SMILESO=C(O)[C@H]1COc2ccccc2O1
InChIInChI=1S/C9H8O4/c10-9(11)8-5-12-6-3-1-2-4-7(6)13-8/h1-4,8H,5H2,(H,10,11)/t8-/m1/s1
InChIKeyHMBHAQMOBKLWRX-MRVPVSSYSA-N
XLogP0.91
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.16
LogP ≤ 50.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid?
The IUPAC name of (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid (CID 687062) is (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid.
What is the SMILES notation for (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid?
The canonical SMILES for (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid is O=C(O)[C@H]1COc2ccccc2O1.
What is the InChIKey of (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid?
The InChIKey is HMBHAQMOBKLWRX-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H8O4/c10-9(11)8-5-12-6-3-1-2-4-7(6)13-8/h1-4,8H,5H2,(H,10,11)/t8-/m1/s1.
What are the key properties of (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid?
(3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid has a molecular weight of 180.16 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,3-dihydro-1,4-benzodioxine-3-carboxylic acid is sourced from PubChem (CID 687062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).