C37H58O7Si — CID 68706686
4-[2-[(7E,12E)-6-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-11-methoxy-2-methyl-13-(4-methyl-3,6-dihydro-2H-pyran-2-yl)-4-methylidenetrideca-7,12-dienyl]-3,6-dihydro-2H-pyran-6-yl]but-2-ynoic acid (PubChem CID 68706686) has the molecular formula C37H58O7Si and a molecular weight of 642.95 g/mol. Its IUPAC name is 4-[2-[(7E,12E)-6-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-11-methoxy-2-methyl-13-(4-methyl-3,6-dihydro-2H-pyran-2-yl)-4-methylidenetrideca-7,12-dienyl]-3,6-dihydro-2H-pyran-6-yl]but-2-ynoic acid.
| Compound Name | 4-[2-[(7E,12E)-6-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-11-methoxy-2-methyl-13-(4-methyl-3,6-dihydro-2H-pyran-2-yl)-4-methylidenetrideca-7,12-dienyl]-3,6-dihydro-2H-pyran-6-yl]but-2-ynoic acid |
|---|---|
| PubChem CID | 68706686 |
| Molecular Formula | C37H58O7Si |
| Molecular Weight | 642.95 g/mol |
| Exact Mass | 642.40 |
| IUPAC Name | 4-[2-[(7E,12E)-6-[tert-butyl(dimethyl)silyl]oxy-10-hydroxy-11-methoxy-2-methyl-13-(4-methyl-3,6-dihydro-2H-pyran-2-yl)-4-methylidenetrideca-7,12-dienyl]-3,6-dihydro-2H-pyran-6-yl]but-2-ynoic acid |
| SMILES | C=C(CC(C)CC1CC=CC(CC#CC(=O)O)O1)CC(/C=C/CC(O)C(/C=C/C1CC(C)=CCO1)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H58O7Si/c1-27-21-22-42-31(24-27)19-20-35(41-7)34(38)17-11-16-33(44-45(8,9)37(4,5)6)26-29(3)23-28(2)25-32-15-10-13-30(43-32)14-12-18-36(39)40/h10-11,13,16,19-21,28,30-35,38H,3,14-15,17,22-26H2,1-2,4-9H3,(H,39,40)/b16-11+,20-19+ |
| InChIKey | QNDCUJILMNEJBI-KERPIWHLSA-N |
| XLogP | 7.54 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.95 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|