C18H23NO2 — CID 68706925
5-cyclopropyl-3-(2-ethyl-4,6-dimethylphenyl)-5-methylpyrrolidine-2,4-dione (PubChem CID 68706925) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 5-cyclopropyl-3-(2-ethyl-4,6-dimethylphenyl)-5-methylpyrrolidine-2,4-dione.
| Compound Name | 5-cyclopropyl-3-(2-ethyl-4,6-dimethylphenyl)-5-methylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 68706925 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 5-cyclopropyl-3-(2-ethyl-4,6-dimethylphenyl)-5-methylpyrrolidine-2,4-dione |
| SMILES | CCc1cc(C)cc(C)c1C1C(=O)NC(C)(C2CC2)C1=O |
| InChI | InChI=1S/C18H23NO2/c1-5-12-9-10(2)8-11(3)14(12)15-16(20)18(4,13-6-7-13)19-17(15)21/h8-9,13,15H,5-7H2,1-4H3,(H,19,21) |
| InChIKey | MOFLNIBNGIXPMT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|