C22H28Cl2N4 — CID 68707036
10-(4-chloro-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride (PubChem CID 68707036) has the molecular formula C22H28Cl2N4 and a molecular weight of 419.40 g/mol. Its IUPAC name is 10-(4-chloro-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride.
| Compound Name | 10-(4-chloro-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 68707036 |
| Molecular Formula | C22H28Cl2N4 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 10-(4-chloro-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine;hydrochloride |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4ccc(Cl)cc4C)c(C)nn13)CCC2.Cl |
| InChI | InChI=1S/C22H27ClN4.ClH/c1-5-16(6-2)24-21-18-8-7-9-19(18)25-22-20(14(4)26-27(21)22)17-11-10-15(23)12-13(17)3;/h10-12,16,24H,5-9H2,1-4H3;1H |
| InChIKey | LWPJURXEIPEDDR-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |