About 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran
6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran (PubChem CID 68707368) has the molecular formula C13H17IO4
and a molecular weight of 364.18 g/mol. Its IUPAC name is 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran |
| PubChem CID | 68707368 |
| Molecular Formula | C13H17IO4 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran |
| SMILES | COC1C=CC(CC2OCCO2)OC1CC#CI |
| InChI | InChI=1S/C13H17IO4/c1-15-11-5-4-10(9-13-16-7-8-17-13)18-12(11)3-2-6-14/h4-5,10-13H,3,7-9H2,1H3 |
| InChIKey | ARRKWCXPOKWFQB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran?
The IUPAC name of 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran (CID 68707368) is 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran.
What is the SMILES notation for 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran?
The canonical SMILES for 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran is COC1C=CC(CC2OCCO2)OC1CC#CI.
What is the InChIKey of 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran?
The InChIKey is ARRKWCXPOKWFQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17IO4/c1-15-11-5-4-10(9-13-16-7-8-17-13)18-12(11)3-2-6-14/h4-5,10-13H,3,7-9H2,1H3.
What are the key properties of 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran?
6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran has a molecular weight of 364.18 g/mol, XLogP of 1.87, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,3-dioxolan-2-ylmethyl)-2-(3-iodoprop-2-ynyl)-3-methoxy-3,6-dihydro-2H-pyran is sourced from PubChem (CID 68707368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).