C29H34F3N3O5 — CID 68707600
[2-oxo-5-[2-[2-[3-(2-phenylethoxy)propanoyl-propan-2-ylamino]ethylamino]ethyl]-1H-quinolin-8-yl] 2,2,2-trifluoroacetate (PubChem CID 68707600) has the molecular formula C29H34F3N3O5 and a molecular weight of 561.60 g/mol. Its IUPAC name is [2-oxo-5-[2-[2-[3-(2-phenylethoxy)propanoyl-propan-2-ylamino]ethylamino]ethyl]-1H-quinolin-8-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-oxo-5-[2-[2-[3-(2-phenylethoxy)propanoyl-propan-2-ylamino]ethylamino]ethyl]-1H-quinolin-8-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68707600 |
| Molecular Formula | C29H34F3N3O5 |
| Molecular Weight | 561.60 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | [2-oxo-5-[2-[2-[3-(2-phenylethoxy)propanoyl-propan-2-ylamino]ethylamino]ethyl]-1H-quinolin-8-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)N(CCNCCc1ccc(OC(=O)C(F)(F)F)c2[nH]c(=O)ccc12)C(=O)CCOCCc1ccccc1 |
| InChI | InChI=1S/C29H34F3N3O5/c1-20(2)35(26(37)14-19-39-18-13-21-6-4-3-5-7-21)17-16-33-15-12-22-8-10-24(40-28(38)29(30,31)32)27-23(22)9-11-25(36)34-27/h3-11,20,33H,12-19H2,1-2H3,(H,34,36) |
| InChIKey | FDUZWBRKJFZESG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|