About N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide (PubChem CID 6870794) has the molecular formula C19H17N3O3
and a molecular weight of 335.36 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide.
Molecular Properties
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide |
| PubChem CID | 6870794 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide |
| SMILES | O=C(CCc1c[nH]c2ccccc12)N/N=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H17N3O3/c23-19(8-6-14-11-20-16-4-2-1-3-15(14)16)22-21-10-13-5-7-17-18(9-13)25-12-24-17/h1-5,7,9-11,20H,6,8,12H2,(H,22,23)/b21-10+ |
| InChIKey | VRVJCKHTHVSUIN-UFFVCSGVSA-N |
| XLogP | 2.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide?
The IUPAC name of N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide (CID 6870794) is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide.
What is the SMILES notation for N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide?
The canonical SMILES for N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide is O=C(CCc1c[nH]c2ccccc12)N/N=C/c1ccc2c(c1)OCO2.
What is the InChIKey of N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide?
The InChIKey is VRVJCKHTHVSUIN-UFFVCSGVSA-N. The full InChI is InChI=1S/C19H17N3O3/c23-19(8-6-14-11-20-16-4-2-1-3-15(14)16)22-21-10-13-5-7-17-18(9-13)25-12-24-17/h1-5,7,9-11,20H,6,8,12H2,(H,22,23)/b21-10+.
What are the key properties of N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide?
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide has a molecular weight of 335.36 g/mol, XLogP of 2.98, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(1H-indol-3-yl)propanamide is sourced from PubChem (CID 6870794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).