About 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one
7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one (PubChem CID 68708060) has the molecular formula C15H12N2O3
and a molecular weight of 268.27 g/mol. Its IUPAC name is 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one.
Molecular Properties
| Compound Name | 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one |
| PubChem CID | 68708060 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one |
| SMILES | COc1ccnc2c1OCC21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C15H12N2O3/c1-19-11-6-7-16-13-12(11)20-8-15(13)9-4-2-3-5-10(9)17-14(15)18/h2-7H,8H2,1H3,(H,17,18) |
| InChIKey | ZIRRXKXPFPNLNB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one?
The IUPAC name of 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one (CID 68708060) is 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one.
What is the SMILES notation for 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one?
The canonical SMILES for 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one is COc1ccnc2c1OCC21C(=O)Nc2ccccc21.
What is the InChIKey of 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one?
The InChIKey is ZIRRXKXPFPNLNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3/c1-19-11-6-7-16-13-12(11)20-8-15(13)9-4-2-3-5-10(9)17-14(15)18/h2-7H,8H2,1H3,(H,17,18).
What are the key properties of 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one?
7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one has a molecular weight of 268.27 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7'-methoxyspiro[1H-indole-3,3'-2H-furo[3,2-b]pyridine]-2-one is sourced from PubChem (CID 68708060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).