About (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid
(2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid (PubChem CID 68708345) has the molecular formula C16H15Cl2F3N2O4
and a molecular weight of 427.21 g/mol. Its IUPAC name is (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid |
| PubChem CID | 68708345 |
| Molecular Formula | C16H15Cl2F3N2O4 |
| Molecular Weight | 427.21 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid |
| SMILES | CCc1c(C(F)(F)F)nn(C)c1Oc1cc(O[C@@H](C)C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H15Cl2F3N2O4/c1-4-8-13(16(19,20)21)22-23(3)14(8)27-12-6-11(9(17)5-10(12)18)26-7(2)15(24)25/h5-7H,4H2,1-3H3,(H,24,25)/t7-/m0/s1 |
| InChIKey | MJPPHAILBJEBAP-ZETCQYMHSA-N |
| XLogP | 4.95 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.21 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid?
The IUPAC name of (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid (CID 68708345) is (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid.
What is the SMILES notation for (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid?
The canonical SMILES for (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid is CCc1c(C(F)(F)F)nn(C)c1Oc1cc(O[C@@H](C)C(=O)O)c(Cl)cc1Cl.
What is the InChIKey of (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid?
The InChIKey is MJPPHAILBJEBAP-ZETCQYMHSA-N. The full InChI is InChI=1S/C16H15Cl2F3N2O4/c1-4-8-13(16(19,20)21)22-23(3)14(8)27-12-6-11(9(17)5-10(12)18)26-7(2)15(24)25/h5-7H,4H2,1-3H3,(H,24,25)/t7-/m0/s1.
What are the key properties of (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid?
(2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid has a molecular weight of 427.21 g/mol, XLogP of 4.95, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[2,4-dichloro-5-[4-ethyl-1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxyphenoxy]propanoic acid is sourced from PubChem (CID 68708345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).