C20H23N5O5 — CID 68709088
(2'R,4'S,4'aS)-2',4'-dimethyl-8'-(5-methyl-2H-1,2,4-oxadiazol-5-yl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione (PubChem CID 68709088) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is (2'R,4'S,4'aS)-2',4'-dimethyl-8'-(5-methyl-2H-1,2,4-oxadiazol-5-yl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione.
| Compound Name | (2'R,4'S,4'aS)-2',4'-dimethyl-8'-(5-methyl-2H-1,2,4-oxadiazol-5-yl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 68709088 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (2'R,4'S,4'aS)-2',4'-dimethyl-8'-(5-methyl-2H-1,2,4-oxadiazol-5-yl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
| SMILES | C[C@@H]1CN2c3ccc(C4(C)N=CNO4)cc3CC3(C(=O)NC(=O)NC3=O)[C@H]2[C@H](C)O1 |
| InChI | InChI=1S/C20H23N5O5/c1-10-8-25-14-5-4-13(19(3)21-9-22-30-19)6-12(14)7-20(15(25)11(2)29-10)16(26)23-18(28)24-17(20)27/h4-6,9-11,15H,7-8H2,1-3H3,(H,21,22)(H2,23,24,26,27,28)/t10-,11+,15-,19?/m1/s1 |
| InChIKey | CZZFHKICLJFPCS-JSEIYSALSA-N |
| XLogP | 0.31 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|