About N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide
N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide (PubChem CID 68709153) has the molecular formula C18H15F3N4O2
and a molecular weight of 376.34 g/mol. Its IUPAC name is N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide.
Molecular Properties
| Compound Name | N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide |
| PubChem CID | 68709153 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide |
| SMILES | CN(NCc1ccc(OC(F)(F)F)cc1)C(=O)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C18H15F3N4O2/c1-25(17(26)13-4-7-15-16(10-13)23-9-8-22-15)24-11-12-2-5-14(6-3-12)27-18(19,20)21/h2-10,24H,11H2,1H3 |
| InChIKey | QQYWJAHAMRHSMZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide?
The IUPAC name of N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide (CID 68709153) is N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide.
What is the SMILES notation for N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide?
The canonical SMILES for N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide is CN(NCc1ccc(OC(F)(F)F)cc1)C(=O)c1ccc2nccnc2c1.
What is the InChIKey of N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide?
The InChIKey is QQYWJAHAMRHSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N4O2/c1-25(17(26)13-4-7-15-16(10-13)23-9-8-22-15)24-11-12-2-5-14(6-3-12)27-18(19,20)21/h2-10,24H,11H2,1H3.
What are the key properties of N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide?
N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide has a molecular weight of 376.34 g/mol, XLogP of 3.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-[[4-(trifluoromethoxy)phenyl]methyl]quinoxaline-6-carbohydrazide is sourced from PubChem (CID 68709153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).