C21H24N2O7 — CID 68709308
[(3R,4S)-3-hydroxy-6-methoxy-2,2-dimethyl-7-nitro-3,4-dihydrochromen-4-yl]-(2-phenylethyl)carbamic acid (PubChem CID 68709308) has the molecular formula C21H24N2O7 and a molecular weight of 416.43 g/mol. Its IUPAC name is [(3R,4S)-3-hydroxy-6-methoxy-2,2-dimethyl-7-nitro-3,4-dihydrochromen-4-yl]-(2-phenylethyl)carbamic acid.
| Compound Name | [(3R,4S)-3-hydroxy-6-methoxy-2,2-dimethyl-7-nitro-3,4-dihydrochromen-4-yl]-(2-phenylethyl)carbamic acid |
|---|---|
| PubChem CID | 68709308 |
| Molecular Formula | C21H24N2O7 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [(3R,4S)-3-hydroxy-6-methoxy-2,2-dimethyl-7-nitro-3,4-dihydrochromen-4-yl]-(2-phenylethyl)carbamic acid |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])OC(C)(C)[C@H](O)[C@H]2N(CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H24N2O7/c1-21(2)19(24)18(22(20(25)26)10-9-13-7-5-4-6-8-13)14-11-17(29-3)15(23(27)28)12-16(14)30-21/h4-8,11-12,18-19,24H,9-10H2,1-3H3,(H,25,26)/t18-,19+/m0/s1 |
| InChIKey | KYTAYCGXZXZNCB-RBUKOAKNSA-N |
| XLogP | 3.40 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|