About 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol
1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol (PubChem CID 68709720) has the molecular formula C7H12N4OS
and a molecular weight of 200.27 g/mol. Its IUPAC name is 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol |
| PubChem CID | 68709720 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol |
| SMILES | Nc1nnc(N2CCC(O)CC2)s1 |
| InChI | InChI=1S/C7H12N4OS/c8-6-9-10-7(13-6)11-3-1-5(12)2-4-11/h5,12H,1-4H2,(H2,8,9) |
| InChIKey | RREJPYIWRUVJPM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol?
The IUPAC name of 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol (CID 68709720) is 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol.
What is the SMILES notation for 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol?
The canonical SMILES for 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol is Nc1nnc(N2CCC(O)CC2)s1.
What is the InChIKey of 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol?
The InChIKey is RREJPYIWRUVJPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4OS/c8-6-9-10-7(13-6)11-3-1-5(12)2-4-11/h5,12H,1-4H2,(H2,8,9).
What are the key properties of 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol?
1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol has a molecular weight of 200.27 g/mol, XLogP of 0.08, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidin-4-ol is sourced from PubChem (CID 68709720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).