About methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate
methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate (PubChem CID 68709759) has the molecular formula C15H10F3N3O3S
and a molecular weight of 369.32 g/mol. Its IUPAC name is methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate |
| PubChem CID | 68709759 |
| Molecular Formula | C15H10F3N3O3S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ncn3c(C(F)(F)F)csc23)cc1 |
| InChI | InChI=1S/C15H10F3N3O3S/c1-24-14(23)9-4-2-8(3-5-9)12(22)20-11-13-21(7-19-11)10(6-25-13)15(16,17)18/h2-7H,1H3,(H,20,22) |
| InChIKey | UVRHOYGUBDBGIY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate?
The IUPAC name of methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate (CID 68709759) is methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate.
What is the SMILES notation for methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate?
The canonical SMILES for methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate is COC(=O)c1ccc(C(=O)Nc2ncn3c(C(F)(F)F)csc23)cc1.
What is the InChIKey of methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate?
The InChIKey is UVRHOYGUBDBGIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F3N3O3S/c1-24-14(23)9-4-2-8(3-5-9)12(22)20-11-13-21(7-19-11)10(6-25-13)15(16,17)18/h2-7H,1H3,(H,20,22).
What are the key properties of methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate?
methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate has a molecular weight of 369.32 g/mol, XLogP of 3.45, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[3-(trifluoromethyl)imidazo[5,1-b][1,3]thiazol-7-yl]carbamoyl]benzoate is sourced from PubChem (CID 68709759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).