C17H17N3O4 — CID 6870979
[2-methoxy-4-[(E)-(phenylcarbamoylhydrazinylidene)methyl]phenyl] acetate (PubChem CID 6870979) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-(phenylcarbamoylhydrazinylidene)methyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(E)-(phenylcarbamoylhydrazinylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 6870979 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [2-methoxy-4-[(E)-(phenylcarbamoylhydrazinylidene)methyl]phenyl] acetate |
| SMILES | COc1cc(/C=N/NC(=O)Nc2ccccc2)ccc1OC(C)=O |
| InChI | InChI=1S/C17H17N3O4/c1-12(21)24-15-9-8-13(10-16(15)23-2)11-18-20-17(22)19-14-6-4-3-5-7-14/h3-11H,1-2H3,(H2,19,20,22)/b18-11+ |
| InChIKey | OHGHUCDLEVTRFQ-WOJGMQOQSA-N |
| XLogP | 2.78 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|