About trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride
trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride (PubChem CID 68710465) has the molecular formula C15H14Cl2FNO2
and a molecular weight of 330.19 g/mol. Its IUPAC name is trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride |
| PubChem CID | 68710465 |
| Molecular Formula | C15H14Cl2FNO2 |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)[C@@H]1C[C@H]1c1ccc(-c2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C15H12FNO2.2ClH/c16-11-4-1-9(2-5-11)14-6-3-10(8-17-14)12-7-13(12)15(18)19;;/h1-6,8,12-13H,7H2,(H,18,19);2*1H/t12-,13+;;/m0../s1 |
| InChIKey | AAOBLTMPYCXAFV-CQSOCPNPSA-N |
| XLogP | 3.92 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride?
The IUPAC name of trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride (CID 68710465) is trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride.
What is the SMILES notation for trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride?
The canonical SMILES for trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride is Cl.Cl.O=C(O)[C@@H]1C[C@H]1c1ccc(-c2ccc(F)cc2)nc1.
What is the InChIKey of trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride?
The InChIKey is AAOBLTMPYCXAFV-CQSOCPNPSA-N. The full InChI is InChI=1S/C15H12FNO2.2ClH/c16-11-4-1-9(2-5-11)14-6-3-10(8-17-14)12-7-13(12)15(18)19;;/h1-6,8,12-13H,7H2,(H,18,19);2*1H/t12-,13+;;/m0../s1.
What are the key properties of trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride?
trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride has a molecular weight of 330.19 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-[6-(4-fluorophenyl)-3-pyridinyl]cyclopropane-1-carboxylic acid;dihydrochloride is sourced from PubChem (CID 68710465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).