C11H16ClN3OS — CID 68710623
2-(4-methylthiophen-2-yl)-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-1-one;hydrochloride (PubChem CID 68710623) has the molecular formula C11H16ClN3OS and a molecular weight of 273.79 g/mol. Its IUPAC name is 2-(4-methylthiophen-2-yl)-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-1-one;hydrochloride.
| Compound Name | 2-(4-methylthiophen-2-yl)-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 68710623 |
| Molecular Formula | C11H16ClN3OS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-(4-methylthiophen-2-yl)-3,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-1-one;hydrochloride |
| SMILES | Cc1csc(N2CN3CCNCC3C2=O)c1.Cl |
| InChI | InChI=1S/C11H15N3OS.ClH/c1-8-4-10(16-6-8)14-7-13-3-2-12-5-9(13)11(14)15;/h4,6,9,12H,2-3,5,7H2,1H3;1H |
| InChIKey | UDCQLGSBMVNMDC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |