About 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide
6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide (PubChem CID 6871117) has the molecular formula C22H16N4O2S
and a molecular weight of 400.46 g/mol. Its IUPAC name is 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide.
Molecular Properties
| Compound Name | 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide |
| PubChem CID | 6871117 |
| Molecular Formula | C22H16N4O2S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide |
| SMILES | O=C(N/N=C/c1cccs1)c1c(-c2ccccc2)c(-c2ccccc2)n[nH]c1=O |
| InChI | InChI=1S/C22H16N4O2S/c27-21(25-23-14-17-12-7-13-29-17)19-18(15-8-3-1-4-9-15)20(24-26-22(19)28)16-10-5-2-6-11-16/h1-14H,(H,25,27)(H,26,28)/b23-14+ |
| InChIKey | AHUGXBBPJOBHSS-OEAKJJBVSA-N |
| XLogP | 3.93 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide?
The IUPAC name of 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide (CID 6871117) is 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide.
What is the SMILES notation for 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide?
The canonical SMILES for 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide is O=C(N/N=C/c1cccs1)c1c(-c2ccccc2)c(-c2ccccc2)n[nH]c1=O.
What is the InChIKey of 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide?
The InChIKey is AHUGXBBPJOBHSS-OEAKJJBVSA-N. The full InChI is InChI=1S/C22H16N4O2S/c27-21(25-23-14-17-12-7-13-29-17)19-18(15-8-3-1-4-9-15)20(24-26-22(19)28)16-10-5-2-6-11-16/h1-14H,(H,25,27)(H,26,28)/b23-14+.
What are the key properties of 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide?
6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide has a molecular weight of 400.46 g/mol, XLogP of 3.93, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-3,4-diphenyl-N-[(E)-thiophen-2-ylmethylideneamino]-1H-pyridazine-5-carboxamide is sourced from PubChem (CID 6871117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).