About 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one
6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one (PubChem CID 68711194) has the molecular formula C20H13F3N2O2S
and a molecular weight of 402.40 g/mol. Its IUPAC name is 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one.
Molecular Properties
| Compound Name | 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one |
| PubChem CID | 68711194 |
| Molecular Formula | C20H13F3N2O2S |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one |
| SMILES | O=c1c2sc(-c3ccc(C(F)(F)F)cc3)cc2cnn1Cc1cccc(O)c1 |
| InChI | InChI=1S/C20H13F3N2O2S/c21-20(22,23)15-6-4-13(5-7-15)17-9-14-10-24-25(19(27)18(14)28-17)11-12-2-1-3-16(26)8-12/h1-10,26H,11H2 |
| InChIKey | KIOCKLWFNVTREX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one?
The IUPAC name of 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one (CID 68711194) is 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one.
What is the SMILES notation for 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one?
The canonical SMILES for 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one is O=c1c2sc(-c3ccc(C(F)(F)F)cc3)cc2cnn1Cc1cccc(O)c1.
What is the InChIKey of 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one?
The InChIKey is KIOCKLWFNVTREX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F3N2O2S/c21-20(22,23)15-6-4-13(5-7-15)17-9-14-10-24-25(19(27)18(14)28-17)11-12-2-1-3-16(26)8-12/h1-10,26H,11H2.
What are the key properties of 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one?
6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one has a molecular weight of 402.40 g/mol, XLogP of 4.90, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3-hydroxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyridazin-7-one is sourced from PubChem (CID 68711194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).