C19H25F2N3O3S — CID 68711259
N-[2-[2-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethoxy]ethyl]propan-2-amine (PubChem CID 68711259) has the molecular formula C19H25F2N3O3S and a molecular weight of 413.49 g/mol. Its IUPAC name is N-[2-[2-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethoxy]ethyl]propan-2-amine.
| Compound Name | N-[2-[2-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethoxy]ethyl]propan-2-amine |
|---|---|
| PubChem CID | 68711259 |
| Molecular Formula | C19H25F2N3O3S |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N-[2-[2-[3-(2,6-difluorophenyl)-2,2-dihydroxy-2λ4,1,3-benzothiadiazol-1-yl]ethoxy]ethyl]propan-2-amine |
| SMILES | CC(C)NCCOCCN1c2ccccc2N(c2c(F)cccc2F)S1(O)O |
| InChI | InChI=1S/C19H25F2N3O3S/c1-14(2)22-10-12-27-13-11-23-17-8-3-4-9-18(17)24(28(23,25)26)19-15(20)6-5-7-16(19)21/h3-9,14,22,25-26H,10-13H2,1-2H3 |
| InChIKey | JFZOLOQFHRMMCM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|