C20H17N5O3S2 — CID 68711305
[4-[2-(2-aminoanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-(1,3-benzothiazol-2-ylmethyl)carbamic acid (PubChem CID 68711305) has the molecular formula C20H17N5O3S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is [4-[2-(2-aminoanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-(1,3-benzothiazol-2-ylmethyl)carbamic acid.
| Compound Name | [4-[2-(2-aminoanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-(1,3-benzothiazol-2-ylmethyl)carbamic acid |
|---|---|
| PubChem CID | 68711305 |
| Molecular Formula | C20H17N5O3S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | [4-[2-(2-aminoanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-(1,3-benzothiazol-2-ylmethyl)carbamic acid |
| SMILES | Nc1ccccc1NC(=O)Cc1csc(N(Cc2nc3ccccc3s2)C(=O)O)n1 |
| InChI | InChI=1S/C20H17N5O3S2/c21-13-5-1-2-6-14(13)23-17(26)9-12-11-29-19(22-12)25(20(27)28)10-18-24-15-7-3-4-8-16(15)30-18/h1-8,11H,9-10,21H2,(H,23,26)(H,27,28) |
| InChIKey | CUEBMJHRGJYSMV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|