C25H32N2O2 — CID 68711501
2-hexanoyl-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 68711501) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 2-hexanoyl-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | 2-hexanoyl-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 68711501 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 2-hexanoyl-N-(2,4,6-trimethylphenyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | CCCCCC(=O)N1CCc2ccccc2C1C(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H32N2O2/c1-5-6-7-12-22(28)27-14-13-20-10-8-9-11-21(20)24(27)25(29)26-23-18(3)15-17(2)16-19(23)4/h8-11,15-16,24H,5-7,12-14H2,1-4H3,(H,26,29) |
| InChIKey | UNHMOSAOQXMDOO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|