About 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid
2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid (PubChem CID 68711644) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid |
| PubChem CID | 68711644 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid |
| SMILES | CCOC1=CCC[C@H](CC)[C@H]1CC(=O)O |
| InChI | InChI=1S/C12H20O3/c1-3-9-6-5-7-11(15-4-2)10(9)8-12(13)14/h7,9-10H,3-6,8H2,1-2H3,(H,13,14)/t9-,10+/m0/s1 |
| InChIKey | MKBMPJGMTNFYLL-VHSXEESVSA-N |
| XLogP | 2.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid?
The IUPAC name of 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid (CID 68711644) is 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid.
What is the SMILES notation for 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid?
The canonical SMILES for 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid is CCOC1=CCC[C@H](CC)[C@H]1CC(=O)O.
What is the InChIKey of 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid?
The InChIKey is MKBMPJGMTNFYLL-VHSXEESVSA-N. The full InChI is InChI=1S/C12H20O3/c1-3-9-6-5-7-11(15-4-2)10(9)8-12(13)14/h7,9-10H,3-6,8H2,1-2H3,(H,13,14)/t9-,10+/m0/s1.
What are the key properties of 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid?
2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid has a molecular weight of 212.29 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,6S)-2-ethoxy-6-ethylcyclohex-2-en-1-yl]acetic acid is sourced from PubChem (CID 68711644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).