About (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol
(3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol (PubChem CID 68712112) has the molecular formula C14H20F2O3S
and a molecular weight of 306.37 g/mol. Its IUPAC name is (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol.
Molecular Properties
| Compound Name | (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol |
| PubChem CID | 68712112 |
| Molecular Formula | C14H20F2O3S |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol |
| SMILES | OCC[C@@H](c1cc(F)cc(F)c1)C1CCS(O)(O)CC1 |
| InChI | InChI=1S/C14H20F2O3S/c15-12-7-11(8-13(16)9-12)14(1-4-17)10-2-5-20(18,19)6-3-10/h7-10,14,17-19H,1-6H2/t14-/m1/s1 |
| InChIKey | MUULCEBNVQIFQK-CQSZACIVSA-N |
| XLogP | 3.59 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol?
The IUPAC name of (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol (CID 68712112) is (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol.
What is the SMILES notation for (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol?
The canonical SMILES for (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol is OCC[C@@H](c1cc(F)cc(F)c1)C1CCS(O)(O)CC1.
What is the InChIKey of (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol?
The InChIKey is MUULCEBNVQIFQK-CQSZACIVSA-N. The full InChI is InChI=1S/C14H20F2O3S/c15-12-7-11(8-13(16)9-12)14(1-4-17)10-2-5-20(18,19)6-3-10/h7-10,14,17-19H,1-6H2/t14-/m1/s1.
What are the key properties of (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol?
(3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol has a molecular weight of 306.37 g/mol, XLogP of 3.59, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(3,5-difluorophenyl)-3-(1,1-dihydroxythian-4-yl)propan-1-ol is sourced from PubChem (CID 68712112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).