About N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide
N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide (PubChem CID 6871240) has the molecular formula C16H12ClN3O4
and a molecular weight of 345.74 g/mol. Its IUPAC name is N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide.
Molecular Properties
| Compound Name | N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide |
| PubChem CID | 6871240 |
| Molecular Formula | C16H12ClN3O4 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide |
| SMILES | O=C(N/N=C/c1ccc2c(c1)OCO2)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H12ClN3O4/c17-11-3-1-2-4-12(11)19-15(21)16(22)20-18-8-10-5-6-13-14(7-10)24-9-23-13/h1-8H,9H2,(H,19,21)(H,20,22)/b18-8+ |
| InChIKey | LPVWJCHVDDHIBM-QGMBQPNBSA-N |
| XLogP | 2.16 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide?
The IUPAC name of N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide (CID 6871240) is N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide.
What is the SMILES notation for N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide?
The canonical SMILES for N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide is O=C(N/N=C/c1ccc2c(c1)OCO2)C(=O)Nc1ccccc1Cl.
What is the InChIKey of N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide?
The InChIKey is LPVWJCHVDDHIBM-QGMBQPNBSA-N. The full InChI is InChI=1S/C16H12ClN3O4/c17-11-3-1-2-4-12(11)19-15(21)16(22)20-18-8-10-5-6-13-14(7-10)24-9-23-13/h1-8H,9H2,(H,19,21)(H,20,22)/b18-8+.
What are the key properties of N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide?
N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide has a molecular weight of 345.74 g/mol, XLogP of 2.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-N-(2-chlorophenyl)oxamide is sourced from PubChem (CID 6871240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).